Lead(II) Nitrate, AR 500g
It is a divalent heavy metal nitrate which can be used in the fabrication of perovskite quantum dot sensitized solar cells (QDSCs).
It can also be used in the formation of chemical sensors.
Also a laboratory analytical reagent
| assay | 99.999% trace metals basis |
| form | crystals and lumps |
| solid | |
| mp | 470 °C (dec.) (lit.) |
| SMILES string | [PbH2++].[O-][N+]([O-])=O.[O-][N+]([O-])=O |
| Weight | 0,6 kg |
|---|---|
| Dimensions | 15 × 15 × 15 cm |
Bestsellers
