Kinetin 99% 5g
Kinetin has been used as a supplement in modified MS medium for culturing various plant tissues. It has also been used to study its effect on thymus and immune function of aging rats.
| product line | BioReagent |
| assay | ≥98% (TLC and HPLC) |
| form | amorphous powder |
| application(s) | cell culture | plant: suitable |
| color | off-white |
| mp | 264-270 °C (dec.) (lit.) |
| Featured Industry | Agriculture |
| SMILES string | C(Nc1ncnc2[nH]cnc12)c3ccco3 |
