Ascorbic Acid C6H8O8 AR 500g
| grade | Laboratory reagent, |
| InChI Key | CIWBSHSKHKDKBQ-JLAZNSOCSA-N |
| grade | puriss. p.a. |
| assay | 99.7-100.5% (oxidimetric) |
| form | solid |
| optical activity | [α]20/D +20.5 to +21.5°, c = 10% in H2O |
| application(s) | cell analysis: suitable |
| impurities | related substances, in accordance (HPLC) |
| ≤0.001% heavy metals (by ICP-OES) | |
| ign. residue | ≤0.05% (as SO4) |
| loss | ≤0.1% loss on drying, 105 °C |
| pH | 2.1-2.6 (20 °C, 5%) |
| mp | 190-194 °C (dec.) |
| solubility | water: soluble 176 g/L at 20 °C |
| anion traces | chloride (Cl–): ≤50 mg/kg |
| sulfate (SO42-): ≤20 mg/kg | |
| cation traces | As: ≤1 mg/kg |
| Cu: ≤5 mg/kg | |
| Fe: ≤2 mg/kg | |
| Pb: ≤5 mg/kg | |
| Zn: ≤10 mg/kg | |
| suitability | complies for appearance of solution |
| passes test for identity (IR) | |
| Agency/Method | Ph Eur |
| SMILES string | OC([C@]([C@@H](O)CO)([H])O1)=C(O)C1=O |
| Gene Information | human … SLC23A2(996 |
| Weight | 0,5 kg |
|---|---|
| Dimensions | 20 × 20 × 20 cm |
Bestsellers
